C22H23N7O4 — CID 23490887
N'-[6-[4-(4-methoxyphenyl)piperazin-1-yl]-5-nitropyrimidin-4-yl]benzohydrazide (PubChem CID 23490887) has the molecular formula C22H23N7O4 and a molecular weight of 449.47 g/mol. Its IUPAC name is N'-[6-[4-(4-methoxyphenyl)piperazin-1-yl]-5-nitropyrimidin-4-yl]benzohydrazide.
| Compound Name | N'-[6-[4-(4-methoxyphenyl)piperazin-1-yl]-5-nitropyrimidin-4-yl]benzohydrazide |
|---|---|
| PubChem CID | 23490887 |
| Molecular Formula | C22H23N7O4 |
| Molecular Weight | 449.47 g/mol |
| Exact Mass | 449.18 |
| IUPAC Name | N'-[6-[4-(4-methoxyphenyl)piperazin-1-yl]-5-nitropyrimidin-4-yl]benzohydrazide |
| SMILES | COc1ccc(N2CCN(c3ncnc(NNC(=O)c4ccccc4)c3[N+](=O)[O-])CC2)cc1 |
| InChI | InChI=1S/C22H23N7O4/c1-33-18-9-7-17(8-10-18)27-11-13-28(14-12-27)21-19(29(31)32)20(23-15-24-21)25-26-22(30)16-5-3-2-4-6-16/h2-10,15H,11-14H2,1H3,(H,26,30)(H,23,24,25) |
| InChIKey | KAPOODFEDCREMG-UHFFFAOYSA-N |
| XLogP | 2.48 |
| TPSA | 125.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.47 |
| LogP ≤ 5 | 2.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|