C16H16Cl2N6O5 — CID 23489626
2-(2,4-dichlorophenoxy)-N'-(6-morpholin-4-yl-5-nitropyrimidin-4-yl)acetohydrazide (PubChem CID 23489626) has the molecular formula C16H16Cl2N6O5 and a molecular weight of 443.25 g/mol. Its IUPAC name is 2-(2,4-dichlorophenoxy)-N'-(6-morpholin-4-yl-5-nitropyrimidin-4-yl)acetohydrazide.
| Compound Name | 2-(2,4-dichlorophenoxy)-N'-(6-morpholin-4-yl-5-nitropyrimidin-4-yl)acetohydrazide |
|---|---|
| PubChem CID | 23489626 |
| Molecular Formula | C16H16Cl2N6O5 |
| Molecular Weight | 443.25 g/mol |
| Exact Mass | 442.06 |
| IUPAC Name | 2-(2,4-dichlorophenoxy)-N'-(6-morpholin-4-yl-5-nitropyrimidin-4-yl)acetohydrazide |
| SMILES | O=C(COc1ccc(Cl)cc1Cl)NNc1ncnc(N2CCOCC2)c1[N+](=O)[O-] |
| InChI | InChI=1S/C16H16Cl2N6O5/c17-10-1-2-12(11(18)7-10)29-8-13(25)21-22-15-14(24(26)27)16(20-9-19-15)23-3-5-28-6-4-23/h1-2,7,9H,3-6,8H2,(H,21,25)(H,19,20,22) |
| InChIKey | SOTUZXQMOJBMHX-UHFFFAOYSA-N |
| XLogP | 2.05 |
| TPSA | 131.75 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.25 |
| LogP ≤ 5 | 2.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|