C17H19ClN8O5 — CID 23490352
4-chloro-N'-[6-(4-ethylpiperazin-1-yl)-5-nitropyrimidin-4-yl]-3-nitrobenzohydrazide (PubChem CID 23490352) has the molecular formula C17H19ClN8O5 and a molecular weight of 450.84 g/mol. Its IUPAC name is 4-chloro-N'-[6-(4-ethylpiperazin-1-yl)-5-nitropyrimidin-4-yl]-3-nitrobenzohydrazide.
| Compound Name | 4-chloro-N'-[6-(4-ethylpiperazin-1-yl)-5-nitropyrimidin-4-yl]-3-nitrobenzohydrazide |
|---|---|
| PubChem CID | 23490352 |
| Molecular Formula | C17H19ClN8O5 |
| Molecular Weight | 450.84 g/mol |
| Exact Mass | 450.12 |
| IUPAC Name | 4-chloro-N'-[6-(4-ethylpiperazin-1-yl)-5-nitropyrimidin-4-yl]-3-nitrobenzohydrazide |
| SMILES | CCN1CCN(c2ncnc(NNC(=O)c3ccc(Cl)c([N+](=O)[O-])c3)c2[N+](=O)[O-])CC1 |
| InChI | InChI=1S/C17H19ClN8O5/c1-2-23-5-7-24(8-6-23)16-14(26(30)31)15(19-10-20-16)21-22-17(27)11-3-4-12(18)13(9-11)25(28)29/h3-4,9-10H,2,5-8H2,1H3,(H,22,27)(H,19,20,21) |
| InChIKey | LTVBWXQUXIRBRW-UHFFFAOYSA-N |
| XLogP | 1.85 |
| TPSA | 159.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.84 |
| LogP ≤ 5 | 1.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|