C17H12ClF3N6O3 — CID 22533481
4-N-[3-chloro-5-(trifluoromethyl)-2-pyridinyl]-6-N-(4-methoxyphenyl)-5-nitropyrimidine-4,6-diamine (PubChem CID 22533481) has the molecular formula C17H12ClF3N6O3 and a molecular weight of 440.77 g/mol. Its IUPAC name is 4-N-[3-chloro-5-(trifluoromethyl)-2-pyridinyl]-6-N-(4-methoxyphenyl)-5-nitropyrimidine-4,6-diamine.
| Compound Name | 4-N-[3-chloro-5-(trifluoromethyl)-2-pyridinyl]-6-N-(4-methoxyphenyl)-5-nitropyrimidine-4,6-diamine |
|---|---|
| PubChem CID | 22533481 |
| Molecular Formula | C17H12ClF3N6O3 |
| Molecular Weight | 440.77 g/mol |
| Exact Mass | 440.06 |
| IUPAC Name | 4-N-[3-chloro-5-(trifluoromethyl)-2-pyridinyl]-6-N-(4-methoxyphenyl)-5-nitropyrimidine-4,6-diamine |
| SMILES | COc1ccc(Nc2ncnc(Nc3ncc(C(F)(F)F)cc3Cl)c2[N+](=O)[O-])cc1 |
| InChI | InChI=1S/C17H12ClF3N6O3/c1-30-11-4-2-10(3-5-11)25-15-13(27(28)29)16(24-8-23-15)26-14-12(18)6-9(7-22-14)17(19,20)21/h2-8H,1H3,(H2,22,23,24,25,26) |
| InChIKey | ZNURTBPKLGISGT-UHFFFAOYSA-N |
| XLogP | 4.95 |
| TPSA | 115.10 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.77 |
| LogP ≤ 5 | 4.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|