C18H12F4N4O3 — CID 45274364
6-[2-fluoro-4-(trifluoromethyl)phenyl]-N-(4-methoxyphenyl)-5-nitropyrimidin-4-amine (PubChem CID 45274364) has the molecular formula C18H12F4N4O3 and a molecular weight of 408.31 g/mol. Its IUPAC name is 6-[2-fluoro-4-(trifluoromethyl)phenyl]-N-(4-methoxyphenyl)-5-nitropyrimidin-4-amine.
| Compound Name | 6-[2-fluoro-4-(trifluoromethyl)phenyl]-N-(4-methoxyphenyl)-5-nitropyrimidin-4-amine |
|---|---|
| PubChem CID | 45274364 |
| Molecular Formula | C18H12F4N4O3 |
| Molecular Weight | 408.31 g/mol |
| Exact Mass | 408.08 |
| IUPAC Name | 6-[2-fluoro-4-(trifluoromethyl)phenyl]-N-(4-methoxyphenyl)-5-nitropyrimidin-4-amine |
| SMILES | COc1ccc(Nc2ncnc(-c3ccc(C(F)(F)F)cc3F)c2[N+](=O)[O-])cc1 |
| InChI | InChI=1S/C18H12F4N4O3/c1-29-12-5-3-11(4-6-12)25-17-16(26(27)28)15(23-9-24-17)13-7-2-10(8-14(13)19)18(20,21)22/h2-9H,1H3,(H,23,24,25) |
| InChIKey | FGKGCZDNHGPMEN-UHFFFAOYSA-N |
| XLogP | 4.96 |
| TPSA | 90.18 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.31 |
| LogP ≤ 5 | 4.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|