C24H21F4N3O3 — CID 11605321
N-(4-tert-butylphenyl)-2-[(2,2,3,3-tetrafluoro-1,4-benzodioxin-6-yl)amino]pyridine-3-carboxamide (PubChem CID 11605321) has the molecular formula C24H21F4N3O3 and a molecular weight of 475.44 g/mol. Its IUPAC name is N-(4-tert-butylphenyl)-2-[(2,2,3,3-tetrafluoro-1,4-benzodioxin-6-yl)amino]pyridine-3-carboxamide.
| Compound Name | N-(4-tert-butylphenyl)-2-[(2,2,3,3-tetrafluoro-1,4-benzodioxin-6-yl)amino]pyridine-3-carboxamide |
|---|---|
| PubChem CID | 11605321 |
| Molecular Formula | C24H21F4N3O3 |
| Molecular Weight | 475.44 g/mol |
| Exact Mass | 475.15 |
| IUPAC Name | N-(4-tert-butylphenyl)-2-[(2,2,3,3-tetrafluoro-1,4-benzodioxin-6-yl)amino]pyridine-3-carboxamide |
| SMILES | CC(C)(C)c1ccc(NC(=O)c2cccnc2Nc2ccc3c(c2)OC(F)(F)C(F)(F)O3)cc1 |
| InChI | InChI=1S/C24H21F4N3O3/c1-22(2,3)14-6-8-15(9-7-14)31-21(32)17-5-4-12-29-20(17)30-16-10-11-18-19(13-16)34-24(27,28)23(25,26)33-18/h4-13H,1-3H3,(H,29,30)(H,31,32) |
| InChIKey | TXHZEUVKOSSQJW-UHFFFAOYSA-N |
| XLogP | 6.33 |
| TPSA | 72.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 475.44 |
| LogP ≤ 5 | 6.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|