About ethane;4-fluoro-N'-hydrazinyl-2-methylbenzenecarboximidamide
ethane;4-fluoro-N'-hydrazinyl-2-methylbenzenecarboximidamide (PubChem CID 169270080) has the molecular formula C10H17FN4
and a molecular weight of 212.27 g/mol. Its IUPAC name is ethane;4-fluoro-N'-hydrazinyl-2-methylbenzenecarboximidamide.
Molecular Properties
| Compound Name | ethane;4-fluoro-N'-hydrazinyl-2-methylbenzenecarboximidamide |
| PubChem CID | 169270080 |
| Molecular Formula | C10H17FN4 |
| Molecular Weight | 212.27 g/mol |
| Exact Mass | 212.14 |
| IUPAC Name | ethane;4-fluoro-N'-hydrazinyl-2-methylbenzenecarboximidamide |
| SMILES | CC.Cc1cc(F)ccc1/C(N)=N/NN |
| InChI | InChI=1S/C8H11FN4.C2H6/c1-5-4-6(9)2-3-7(5)8(10)12-13-11;1-2/h2-4,13H,11H2,1H3,(H2,10,12);1-2H3 |
| InChIKey | RYWXFJHPFLXLNB-UHFFFAOYSA-N |
| XLogP | 1.24 |
| TPSA | 76.43 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 212.27 |
| LogP ≤ 5 | 1.24 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze ethane;4-fluoro-N'-hydrazinyl-2-methylbenzenecarboximidamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethane;4-fluoro-N'-hydrazinyl-2-methylbenzenecarboximidamide?
The IUPAC name of ethane;4-fluoro-N'-hydrazinyl-2-methylbenzenecarboximidamide (CID 169270080) is ethane;4-fluoro-N'-hydrazinyl-2-methylbenzenecarboximidamide.
What is the SMILES notation for ethane;4-fluoro-N'-hydrazinyl-2-methylbenzenecarboximidamide?
The canonical SMILES for ethane;4-fluoro-N'-hydrazinyl-2-methylbenzenecarboximidamide is CC.Cc1cc(F)ccc1/C(N)=N/NN.
What is the InChIKey of ethane;4-fluoro-N'-hydrazinyl-2-methylbenzenecarboximidamide?
The InChIKey is RYWXFJHPFLXLNB-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H11FN4.C2H6/c1-5-4-6(9)2-3-7(5)8(10)12-13-11;1-2/h2-4,13H,11H2,1H3,(H2,10,12);1-2H3.
What are the key properties of ethane;4-fluoro-N'-hydrazinyl-2-methylbenzenecarboximidamide?
ethane;4-fluoro-N'-hydrazinyl-2-methylbenzenecarboximidamide has a molecular weight of 212.27 g/mol, XLogP of 1.24, 2 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for ethane;4-fluoro-N'-hydrazinyl-2-methylbenzenecarboximidamide is sourced from PubChem (CID 169270080), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).