C18H11F5N4O — CID 113051572
N-[6-(2,6-difluoroanilino)pyridazin-3-yl]-4-(trifluoromethyl)benzamide (PubChem CID 113051572) has the molecular formula C18H11F5N4O and a molecular weight of 394.30 g/mol. Its IUPAC name is N-[6-(2,6-difluoroanilino)pyridazin-3-yl]-4-(trifluoromethyl)benzamide.
| Compound Name | N-[6-(2,6-difluoroanilino)pyridazin-3-yl]-4-(trifluoromethyl)benzamide |
|---|---|
| PubChem CID | 113051572 |
| Molecular Formula | C18H11F5N4O |
| Molecular Weight | 394.30 g/mol |
| Exact Mass | 394.09 |
| IUPAC Name | N-[6-(2,6-difluoroanilino)pyridazin-3-yl]-4-(trifluoromethyl)benzamide |
| SMILES | O=C(Nc1ccc(Nc2c(F)cccc2F)nn1)c1ccc(C(F)(F)F)cc1 |
| InChI | InChI=1S/C18H11F5N4O/c19-12-2-1-3-13(20)16(12)24-14-8-9-15(27-26-14)25-17(28)10-4-6-11(7-5-10)18(21,22)23/h1-9H,(H,24,26)(H,25,27,28) |
| InChIKey | BSEUVHCBMYYHAQ-UHFFFAOYSA-N |
| XLogP | 4.77 |
| TPSA | 66.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.30 |
| LogP ≤ 5 | 4.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |