C17H19F3N6 — CID 142468290
N'-[2-(methylamino)ethyldiazenyl]-2-[3-(trifluoromethyl)anilino]benzenecarboximidamide (PubChem CID 142468290) has the molecular formula C17H19F3N6 and a molecular weight of 364.38 g/mol. Its IUPAC name is N'-[2-(methylamino)ethyldiazenyl]-2-[3-(trifluoromethyl)anilino]benzenecarboximidamide.
| Compound Name | N'-[2-(methylamino)ethyldiazenyl]-2-[3-(trifluoromethyl)anilino]benzenecarboximidamide |
|---|---|
| PubChem CID | 142468290 |
| Molecular Formula | C17H19F3N6 |
| Molecular Weight | 364.38 g/mol |
| Exact Mass | 364.16 |
| IUPAC Name | N'-[2-(methylamino)ethyldiazenyl]-2-[3-(trifluoromethyl)anilino]benzenecarboximidamide |
| SMILES | CNCC/N=N/N=C(\N)c1ccccc1Nc1cccc(C(F)(F)F)c1 |
| InChI | InChI=1S/C17H19F3N6/c1-22-9-10-23-26-25-16(21)14-7-2-3-8-15(14)24-13-6-4-5-12(11-13)17(18,19)20/h2-8,11,22,24H,9-10H2,1H3,(H2,21,23,25) |
| InChIKey | OTZSGGRNJVDTRM-UHFFFAOYSA-N |
| XLogP | 3.74 |
| TPSA | 87.16 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.38 |
| LogP ≤ 5 | 3.74 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|