C17H19F3N2 — CID 155344319
4-tert-butyl-3-N-[3-(trifluoromethyl)phenyl]benzene-1,3-diamine (PubChem CID 155344319) has the molecular formula C17H19F3N2 and a molecular weight of 308.35 g/mol. Its IUPAC name is 4-tert-butyl-3-N-[3-(trifluoromethyl)phenyl]benzene-1,3-diamine.
| Compound Name | 4-tert-butyl-3-N-[3-(trifluoromethyl)phenyl]benzene-1,3-diamine |
|---|---|
| PubChem CID | 155344319 |
| Molecular Formula | C17H19F3N2 |
| Molecular Weight | 308.35 g/mol |
| Exact Mass | 308.15 |
| IUPAC Name | 4-tert-butyl-3-N-[3-(trifluoromethyl)phenyl]benzene-1,3-diamine |
| SMILES | CC(C)(C)c1ccc(N)cc1Nc1cccc(C(F)(F)F)c1 |
| InChI | InChI=1S/C17H19F3N2/c1-16(2,3)14-8-7-12(21)10-15(14)22-13-6-4-5-11(9-13)17(18,19)20/h4-10,22H,21H2,1-3H3 |
| InChIKey | PCNJJKNYIHLHRD-UHFFFAOYSA-N |
| XLogP | 5.33 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.35 |
| LogP ≤ 5 | 5.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|