C24H35N — CID 177290254
3,4-ditert-butyl-N-(3-tert-butylphenyl)aniline (PubChem CID 177290254) has the molecular formula C24H35N and a molecular weight of 337.55 g/mol. Its IUPAC name is 3,4-ditert-butyl-N-(3-tert-butylphenyl)aniline.
| Compound Name | 3,4-ditert-butyl-N-(3-tert-butylphenyl)aniline |
|---|---|
| PubChem CID | 177290254 |
| Molecular Formula | C24H35N |
| Molecular Weight | 337.55 g/mol |
| Exact Mass | 337.28 |
| IUPAC Name | 3,4-ditert-butyl-N-(3-tert-butylphenyl)aniline |
| SMILES | CC(C)(C)c1cccc(Nc2ccc(C(C)(C)C)c(C(C)(C)C)c2)c1 |
| InChI | InChI=1S/C24H35N/c1-22(2,3)17-11-10-12-18(15-17)25-19-13-14-20(23(4,5)6)21(16-19)24(7,8)9/h10-16,25H,1-9H3 |
| InChIKey | YMQSVWBYRJUXFE-UHFFFAOYSA-N |
| XLogP | 7.32 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.55 |
| LogP ≤ 5 | 7.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |