C14H8F7N — CID 155290773
N-(3-fluorophenyl)-2,5-bis(trifluoromethyl)aniline (PubChem CID 155290773) has the molecular formula C14H8F7N and a molecular weight of 323.21 g/mol. Its IUPAC name is N-(3-fluorophenyl)-2,5-bis(trifluoromethyl)aniline.
| Compound Name | N-(3-fluorophenyl)-2,5-bis(trifluoromethyl)aniline |
|---|---|
| PubChem CID | 155290773 |
| Molecular Formula | C14H8F7N |
| Molecular Weight | 323.21 g/mol |
| Exact Mass | 323.05 |
| IUPAC Name | N-(3-fluorophenyl)-2,5-bis(trifluoromethyl)aniline |
| SMILES | Fc1cccc(Nc2cc(C(F)(F)F)ccc2C(F)(F)F)c1 |
| InChI | InChI=1S/C14H8F7N/c15-9-2-1-3-10(7-9)22-12-6-8(13(16,17)18)4-5-11(12)14(19,20)21/h1-7,22H |
| InChIKey | UZWDNHOVHHOQOZ-UHFFFAOYSA-N |
| XLogP | 5.61 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.21 |
| LogP ≤ 5 | 5.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |