C14H9F6NO — CID 155290288
2-[2,5-bis(trifluoromethyl)anilino]phenol (PubChem CID 155290288) has the molecular formula C14H9F6NO and a molecular weight of 321.22 g/mol. Its IUPAC name is 2-[2,5-bis(trifluoromethyl)anilino]phenol.
| Compound Name | 2-[2,5-bis(trifluoromethyl)anilino]phenol |
|---|---|
| PubChem CID | 155290288 |
| Molecular Formula | C14H9F6NO |
| Molecular Weight | 321.22 g/mol |
| Exact Mass | 321.06 |
| IUPAC Name | 2-[2,5-bis(trifluoromethyl)anilino]phenol |
| SMILES | Oc1ccccc1Nc1cc(C(F)(F)F)ccc1C(F)(F)F |
| InChI | InChI=1S/C14H9F6NO/c15-13(16,17)8-5-6-9(14(18,19)20)11(7-8)21-10-3-1-2-4-12(10)22/h1-7,21-22H |
| InChIKey | UGRLZRAAMKICTK-UHFFFAOYSA-N |
| XLogP | 5.17 |
| TPSA | 32.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.22 |
| LogP ≤ 5 | 5.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|