C16H15ClF3NO — CID 142657736
3-[2-[2-chloro-5-(trifluoromethyl)anilino]phenyl]propan-1-ol (PubChem CID 142657736) has the molecular formula C16H15ClF3NO and a molecular weight of 329.75 g/mol. Its IUPAC name is 3-[2-[2-chloro-5-(trifluoromethyl)anilino]phenyl]propan-1-ol.
| Compound Name | 3-[2-[2-chloro-5-(trifluoromethyl)anilino]phenyl]propan-1-ol |
|---|---|
| PubChem CID | 142657736 |
| Molecular Formula | C16H15ClF3NO |
| Molecular Weight | 329.75 g/mol |
| Exact Mass | 329.08 |
| IUPAC Name | 3-[2-[2-chloro-5-(trifluoromethyl)anilino]phenyl]propan-1-ol |
| SMILES | OCCCc1ccccc1Nc1cc(C(F)(F)F)ccc1Cl |
| InChI | InChI=1S/C16H15ClF3NO/c17-13-8-7-12(16(18,19)20)10-15(13)21-14-6-2-1-4-11(14)5-3-9-22/h1-2,4,6-8,10,21-22H,3,5,9H2 |
| InChIKey | AGYPJHXPVTVVBT-UHFFFAOYSA-N |
| XLogP | 5.03 |
| TPSA | 32.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.75 |
| LogP ≤ 5 | 5.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |