C18H17F3N2O2 — CID 166247033
N-(oxetan-3-ylmethyl)-2-[3-(trifluoromethyl)anilino]benzamide (PubChem CID 166247033) has the molecular formula C18H17F3N2O2 and a molecular weight of 350.34 g/mol. Its IUPAC name is N-(oxetan-3-ylmethyl)-2-[3-(trifluoromethyl)anilino]benzamide.
| Compound Name | N-(oxetan-3-ylmethyl)-2-[3-(trifluoromethyl)anilino]benzamide |
|---|---|
| PubChem CID | 166247033 |
| Molecular Formula | C18H17F3N2O2 |
| Molecular Weight | 350.34 g/mol |
| Exact Mass | 350.12 |
| IUPAC Name | N-(oxetan-3-ylmethyl)-2-[3-(trifluoromethyl)anilino]benzamide |
| SMILES | O=C(NCC1COC1)c1ccccc1Nc1cccc(C(F)(F)F)c1 |
| InChI | InChI=1S/C18H17F3N2O2/c19-18(20,21)13-4-3-5-14(8-13)23-16-7-2-1-6-15(16)17(24)22-9-12-10-25-11-12/h1-8,12,23H,9-11H2,(H,22,24) |
| InChIKey | PQIDIWPEUUNXJH-UHFFFAOYSA-N |
| XLogP | 3.83 |
| TPSA | 50.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.34 |
| LogP ≤ 5 | 3.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |