C23H20F3NO3 — CID 68502522
[3-(trifluoromethyl)phenyl]methyl 2-benzyl-3-hydroxy-3-pyridin-3-ylpropanoate (PubChem CID 68502522) has the molecular formula C23H20F3NO3 and a molecular weight of 415.41 g/mol. Its IUPAC name is [3-(trifluoromethyl)phenyl]methyl 2-benzyl-3-hydroxy-3-pyridin-3-ylpropanoate.
| Compound Name | [3-(trifluoromethyl)phenyl]methyl 2-benzyl-3-hydroxy-3-pyridin-3-ylpropanoate |
|---|---|
| PubChem CID | 68502522 |
| Molecular Formula | C23H20F3NO3 |
| Molecular Weight | 415.41 g/mol |
| Exact Mass | 415.14 |
| IUPAC Name | [3-(trifluoromethyl)phenyl]methyl 2-benzyl-3-hydroxy-3-pyridin-3-ylpropanoate |
| SMILES | O=C(OCc1cccc(C(F)(F)F)c1)C(Cc1ccccc1)C(O)c1cccnc1 |
| InChI | InChI=1S/C23H20F3NO3/c24-23(25,26)19-10-4-8-17(12-19)15-30-22(29)20(13-16-6-2-1-3-7-16)21(28)18-9-5-11-27-14-18/h1-12,14,20-21,28H,13,15H2 |
| InChIKey | BNWLVBQXKAZZQW-UHFFFAOYSA-N |
| XLogP | 4.74 |
| TPSA | 59.42 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.41 |
| LogP ≤ 5 | 4.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |