C23H18F3NO3 — CID 11560641
[3-(trifluoromethyl)phenyl]methyl (Z)-2-[hydroxy(pyridin-3-yl)methyl]-3-phenylprop-2-enoate (PubChem CID 11560641) has the molecular formula C23H18F3NO3 and a molecular weight of 413.40 g/mol. Its IUPAC name is [3-(trifluoromethyl)phenyl]methyl (Z)-2-[hydroxy(pyridin-3-yl)methyl]-3-phenylprop-2-enoate.
| Compound Name | [3-(trifluoromethyl)phenyl]methyl (Z)-2-[hydroxy(pyridin-3-yl)methyl]-3-phenylprop-2-enoate |
|---|---|
| PubChem CID | 11560641 |
| Molecular Formula | C23H18F3NO3 |
| Molecular Weight | 413.40 g/mol |
| Exact Mass | 413.12 |
| IUPAC Name | [3-(trifluoromethyl)phenyl]methyl (Z)-2-[hydroxy(pyridin-3-yl)methyl]-3-phenylprop-2-enoate |
| SMILES | O=C(OCc1cccc(C(F)(F)F)c1)/C(=C\c1ccccc1)C(O)c1cccnc1 |
| InChI | InChI=1S/C23H18F3NO3/c24-23(25,26)19-10-4-8-17(12-19)15-30-22(29)20(13-16-6-2-1-3-7-16)21(28)18-9-5-11-27-14-18/h1-14,21,28H,15H2/b20-13- |
| InChIKey | ANRMKZGNHYXABX-MOSHPQCFSA-N |
| XLogP | 4.96 |
| TPSA | 59.42 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.40 |
| LogP ≤ 5 | 4.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|