C25H27ClF3NO3 — CID 143158198
acetylene;3-chloroprop-1-ene;[3-(trifluoromethyl)phenyl]methyl (Z)-2-[hydroxy(pyridin-3-yl)methyl]hex-4-enoate (PubChem CID 143158198) has the molecular formula C25H27ClF3NO3 and a molecular weight of 481.94 g/mol. Its IUPAC name is acetylene;3-chloroprop-1-ene;[3-(trifluoromethyl)phenyl]methyl (Z)-2-[hydroxy(pyridin-3-yl)methyl]hex-4-enoate.
| Compound Name | acetylene;3-chloroprop-1-ene;[3-(trifluoromethyl)phenyl]methyl (Z)-2-[hydroxy(pyridin-3-yl)methyl]hex-4-enoate |
|---|---|
| PubChem CID | 143158198 |
| Molecular Formula | C25H27ClF3NO3 |
| Molecular Weight | 481.94 g/mol |
| Exact Mass | 481.16 |
| IUPAC Name | acetylene;3-chloroprop-1-ene;[3-(trifluoromethyl)phenyl]methyl (Z)-2-[hydroxy(pyridin-3-yl)methyl]hex-4-enoate |
| SMILES | C#C.C/C=C\CC(C(=O)OCc1cccc(C(F)(F)F)c1)C(O)c1cccnc1.C=CCCl |
| InChI | InChI=1S/C20H20F3NO3.C3H5Cl.C2H2/c1-2-3-9-17(18(25)15-7-5-10-24-12-15)19(26)27-13-14-6-4-8-16(11-14)20(21,22)23;1-2-3-4;1-2/h2-8,10-12,17-18,25H,9,13H2,1H3;2H,1,3H2;1-2H/b3-2-;; |
| InChIKey | DDWCCCQFXZSNNY-BGQPXYRPSA-N |
| XLogP | 6.12 |
| TPSA | 59.42 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 481.94 |
| LogP ≤ 5 | 6.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|