C15H13Cl2F3O2 — CID 143298387
(Z,3E)-6-chloro-3-ethylidene-2-[3-(trifluoromethyl)phenoxy]hex-4-enoyl chloride (PubChem CID 143298387) has the molecular formula C15H13Cl2F3O2 and a molecular weight of 353.17 g/mol. Its IUPAC name is (Z,3E)-6-chloro-3-ethylidene-2-[3-(trifluoromethyl)phenoxy]hex-4-enoyl chloride.
| Compound Name | (Z,3E)-6-chloro-3-ethylidene-2-[3-(trifluoromethyl)phenoxy]hex-4-enoyl chloride |
|---|---|
| PubChem CID | 143298387 |
| Molecular Formula | C15H13Cl2F3O2 |
| Molecular Weight | 353.17 g/mol |
| Exact Mass | 352.02 |
| IUPAC Name | (Z,3E)-6-chloro-3-ethylidene-2-[3-(trifluoromethyl)phenoxy]hex-4-enoyl chloride |
| SMILES | C/C=C(\C=C/CCl)C(Oc1cccc(C(F)(F)F)c1)C(=O)Cl |
| InChI | InChI=1S/C15H13Cl2F3O2/c1-2-10(5-4-8-16)13(14(17)21)22-12-7-3-6-11(9-12)15(18,19)20/h2-7,9,13H,8H2,1H3/b5-4-,10-2+ |
| InChIKey | PTRPSRWIYBTCRZ-BNIAPZMKSA-N |
| XLogP | 4.96 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.17 |
| LogP ≤ 5 | 4.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'acid_halide', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|