C23H31BrN2O4 — CID 54599011
2-[7-[[carboxy(phenyl)methyl]amino]heptylamino]-2-phenylacetic acid;hydrobromide (PubChem CID 54599011) has the molecular formula C23H31BrN2O4 and a molecular weight of 479.42 g/mol. Its IUPAC name is 2-[7-[[carboxy(phenyl)methyl]amino]heptylamino]-2-phenylacetic acid;hydrobromide.
| Compound Name | 2-[7-[[carboxy(phenyl)methyl]amino]heptylamino]-2-phenylacetic acid;hydrobromide |
|---|---|
| PubChem CID | 54599011 |
| Molecular Formula | C23H31BrN2O4 |
| Molecular Weight | 479.42 g/mol |
| Exact Mass | 478.15 |
| IUPAC Name | 2-[7-[[carboxy(phenyl)methyl]amino]heptylamino]-2-phenylacetic acid;hydrobromide |
| SMILES | Br.O=C(O)C(NCCCCCCCNC(C(=O)O)c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C23H30N2O4.BrH/c26-22(27)20(18-12-6-4-7-13-18)24-16-10-2-1-3-11-17-25-21(23(28)29)19-14-8-5-9-15-19;/h4-9,12-15,20-21,24-25H,1-3,10-11,16-17H2,(H,26,27)(H,28,29);1H |
| InChIKey | GBLOSMVYSJRKAP-UHFFFAOYSA-N |
| XLogP | 4.35 |
| TPSA | 98.66 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 479.42 |
| LogP ≤ 5 | 4.35 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|