C16H17FN2O — CID 33406037
(2S)-2-[2-(4-fluorophenyl)ethylamino]-2-phenylacetamide (PubChem CID 33406037) has the molecular formula C16H17FN2O and a molecular weight of 272.32 g/mol. Its IUPAC name is (2S)-2-[2-(4-fluorophenyl)ethylamino]-2-phenylacetamide.
| Compound Name | (2S)-2-[2-(4-fluorophenyl)ethylamino]-2-phenylacetamide |
|---|---|
| PubChem CID | 33406037 |
| Molecular Formula | C16H17FN2O |
| Molecular Weight | 272.32 g/mol |
| Exact Mass | 272.13 |
| IUPAC Name | (2S)-2-[2-(4-fluorophenyl)ethylamino]-2-phenylacetamide |
| SMILES | NC(=O)[C@@H](NCCc1ccc(F)cc1)c1ccccc1 |
| InChI | InChI=1S/C16H17FN2O/c17-14-8-6-12(7-9-14)10-11-19-15(16(18)20)13-4-2-1-3-5-13/h1-9,15,19H,10-11H2,(H2,18,20)/t15-/m0/s1 |
| InChIKey | IPSSKKYMZUPTNY-HNNXBMFYSA-N |
| XLogP | 2.18 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.32 |
| LogP ≤ 5 | 2.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |