C13H21N2OP — CID 71108651
(2R)-2-[[butyl(methyl)phosphanyl]amino]-2-phenylacetamide (PubChem CID 71108651) has the molecular formula C13H21N2OP and a molecular weight of 252.30 g/mol. Its IUPAC name is (2R)-2-[[butyl(methyl)phosphanyl]amino]-2-phenylacetamide.
| Compound Name | (2R)-2-[[butyl(methyl)phosphanyl]amino]-2-phenylacetamide |
|---|---|
| PubChem CID | 71108651 |
| Molecular Formula | C13H21N2OP |
| Molecular Weight | 252.30 g/mol |
| Exact Mass | 252.14 |
| IUPAC Name | (2R)-2-[[butyl(methyl)phosphanyl]amino]-2-phenylacetamide |
| SMILES | CCCC[P@](C)N[C@@H](C(N)=O)c1ccccc1 |
| InChI | InChI=1S/C13H21N2OP/c1-3-4-10-17(2)15-12(13(14)16)11-8-6-5-7-9-11/h5-9,12,15H,3-4,10H2,1-2H3,(H2,14,16)/t12-,17+/m1/s1 |
| InChIKey | UJRBGTWKQZNWAB-PXAZEXFGSA-N |
| XLogP | 2.63 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.30 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|