C17H18ClNO4S — CID 162906955
4-(4-chlorophenyl)sulfonyl-6-phenoxy-1,4-oxazepane (PubChem CID 162906955) has the molecular formula C17H18ClNO4S and a molecular weight of 367.85 g/mol. Its IUPAC name is 4-(4-chlorophenyl)sulfonyl-6-phenoxy-1,4-oxazepane.
| Compound Name | 4-(4-chlorophenyl)sulfonyl-6-phenoxy-1,4-oxazepane |
|---|---|
| PubChem CID | 162906955 |
| Molecular Formula | C17H18ClNO4S |
| Molecular Weight | 367.85 g/mol |
| Exact Mass | 367.06 |
| IUPAC Name | 4-(4-chlorophenyl)sulfonyl-6-phenoxy-1,4-oxazepane |
| SMILES | O=S(=O)(c1ccc(Cl)cc1)N1CCOCC(Oc2ccccc2)C1 |
| InChI | InChI=1S/C17H18ClNO4S/c18-14-6-8-17(9-7-14)24(20,21)19-10-11-22-13-16(12-19)23-15-4-2-1-3-5-15/h1-9,16H,10-13H2 |
| InChIKey | KGPMBVQPFBYFIV-UHFFFAOYSA-N |
| XLogP | 2.81 |
| TPSA | 55.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.85 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |