C14H20FNO5S — CID 75367821
(6R)-4-(4-fluorophenyl)sulfonyl-6-(2-methoxyethoxy)-1,4-oxazepane (PubChem CID 75367821) has the molecular formula C14H20FNO5S and a molecular weight of 333.38 g/mol. Its IUPAC name is (6R)-4-(4-fluorophenyl)sulfonyl-6-(2-methoxyethoxy)-1,4-oxazepane.
| Compound Name | (6R)-4-(4-fluorophenyl)sulfonyl-6-(2-methoxyethoxy)-1,4-oxazepane |
|---|---|
| PubChem CID | 75367821 |
| Molecular Formula | C14H20FNO5S |
| Molecular Weight | 333.38 g/mol |
| Exact Mass | 333.10 |
| IUPAC Name | (6R)-4-(4-fluorophenyl)sulfonyl-6-(2-methoxyethoxy)-1,4-oxazepane |
| SMILES | COCCO[C@H]1COCCN(S(=O)(=O)c2ccc(F)cc2)C1 |
| InChI | InChI=1S/C14H20FNO5S/c1-19-8-9-21-13-10-16(6-7-20-11-13)22(17,18)14-4-2-12(15)3-5-14/h2-5,13H,6-11H2,1H3/t13-/m1/s1 |
| InChIKey | CQVOMZCLRUEIHL-CYBMUJFWSA-N |
| XLogP | 0.88 |
| TPSA | 65.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.38 |
| LogP ≤ 5 | 0.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|