C21H26ClNO4S — CID 110154938
(3S,4S)-1-(4-chlorophenyl)sulfonyl-4-(2-methylpropyl)-3-phenoxypiperidin-4-ol (PubChem CID 110154938) has the molecular formula C21H26ClNO4S and a molecular weight of 423.96 g/mol. Its IUPAC name is (3S,4S)-1-(4-chlorophenyl)sulfonyl-4-(2-methylpropyl)-3-phenoxypiperidin-4-ol.
| Compound Name | (3S,4S)-1-(4-chlorophenyl)sulfonyl-4-(2-methylpropyl)-3-phenoxypiperidin-4-ol |
|---|---|
| PubChem CID | 110154938 |
| Molecular Formula | C21H26ClNO4S |
| Molecular Weight | 423.96 g/mol |
| Exact Mass | 423.13 |
| IUPAC Name | (3S,4S)-1-(4-chlorophenyl)sulfonyl-4-(2-methylpropyl)-3-phenoxypiperidin-4-ol |
| SMILES | CC(C)C[C@]1(O)CCN(S(=O)(=O)c2ccc(Cl)cc2)C[C@@H]1Oc1ccccc1 |
| InChI | InChI=1S/C21H26ClNO4S/c1-16(2)14-21(24)12-13-23(15-20(21)27-18-6-4-3-5-7-18)28(25,26)19-10-8-17(22)9-11-19/h3-11,16,20,24H,12-15H2,1-2H3/t20-,21+/m0/s1 |
| InChIKey | VTVVBNOYHMKAKX-LEWJYISDSA-N |
| XLogP | 3.96 |
| TPSA | 66.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.96 |
| LogP ≤ 5 | 3.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |