C21H24ClNO6S — CID 10694998
2-[3-[1-(4-chlorophenyl)sulfonyl-4-hydroxypiperidin-4-yl]phenoxy]-2-methylpropanoic acid (PubChem CID 10694998) has the molecular formula C21H24ClNO6S and a molecular weight of 453.94 g/mol. Its IUPAC name is 2-[3-[1-(4-chlorophenyl)sulfonyl-4-hydroxypiperidin-4-yl]phenoxy]-2-methylpropanoic acid.
| Compound Name | 2-[3-[1-(4-chlorophenyl)sulfonyl-4-hydroxypiperidin-4-yl]phenoxy]-2-methylpropanoic acid |
|---|---|
| PubChem CID | 10694998 |
| Molecular Formula | C21H24ClNO6S |
| Molecular Weight | 453.94 g/mol |
| Exact Mass | 453.10 |
| IUPAC Name | 2-[3-[1-(4-chlorophenyl)sulfonyl-4-hydroxypiperidin-4-yl]phenoxy]-2-methylpropanoic acid |
| SMILES | CC(C)(Oc1cccc(C2(O)CCN(S(=O)(=O)c3ccc(Cl)cc3)CC2)c1)C(=O)O |
| InChI | InChI=1S/C21H24ClNO6S/c1-20(2,19(24)25)29-17-5-3-4-15(14-17)21(26)10-12-23(13-11-21)30(27,28)18-8-6-16(22)7-9-18/h3-9,14,26H,10-13H2,1-2H3,(H,24,25) |
| InChIKey | BNCDIZBIBATHPQ-UHFFFAOYSA-N |
| XLogP | 3.25 |
| TPSA | 104.14 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 453.94 |
| LogP ≤ 5 | 3.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |