About 1-[4-(bromomethyl)phenyl]sulfonyl-4,4-dimethylazepane
1-[4-(bromomethyl)phenyl]sulfonyl-4,4-dimethylazepane (PubChem CID 65481831) has the molecular formula C15H22BrNO2S
and a molecular weight of 360.32 g/mol. Its IUPAC name is 1-[4-(bromomethyl)phenyl]sulfonyl-4,4-dimethylazepane.
Molecular Properties
| Compound Name | 1-[4-(bromomethyl)phenyl]sulfonyl-4,4-dimethylazepane |
| PubChem CID | 65481831 |
| Molecular Formula | C15H22BrNO2S |
| Molecular Weight | 360.32 g/mol |
| Exact Mass | 359.06 |
| IUPAC Name | 1-[4-(bromomethyl)phenyl]sulfonyl-4,4-dimethylazepane |
| SMILES | CC1(C)CCCN(S(=O)(=O)c2ccc(CBr)cc2)CC1 |
| InChI | InChI=1S/C15H22BrNO2S/c1-15(2)8-3-10-17(11-9-15)20(18,19)14-6-4-13(12-16)5-7-14/h4-7H,3,8-12H2,1-2H3 |
| InChIKey | AMKIFIXVJOTUNV-UHFFFAOYSA-N |
| XLogP | 3.78 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 360.32 |
| LogP ≤ 5 | 3.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze 1-[4-(bromomethyl)phenyl]sulfonyl-4,4-dimethylazepane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[4-(bromomethyl)phenyl]sulfonyl-4,4-dimethylazepane?
The IUPAC name of 1-[4-(bromomethyl)phenyl]sulfonyl-4,4-dimethylazepane (CID 65481831) is 1-[4-(bromomethyl)phenyl]sulfonyl-4,4-dimethylazepane.
What is the SMILES notation for 1-[4-(bromomethyl)phenyl]sulfonyl-4,4-dimethylazepane?
The canonical SMILES for 1-[4-(bromomethyl)phenyl]sulfonyl-4,4-dimethylazepane is CC1(C)CCCN(S(=O)(=O)c2ccc(CBr)cc2)CC1.
What is the InChIKey of 1-[4-(bromomethyl)phenyl]sulfonyl-4,4-dimethylazepane?
The InChIKey is AMKIFIXVJOTUNV-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H22BrNO2S/c1-15(2)8-3-10-17(11-9-15)20(18,19)14-6-4-13(12-16)5-7-14/h4-7H,3,8-12H2,1-2H3.
What are the key properties of 1-[4-(bromomethyl)phenyl]sulfonyl-4,4-dimethylazepane?
1-[4-(bromomethyl)phenyl]sulfonyl-4,4-dimethylazepane has a molecular weight of 360.32 g/mol, XLogP of 3.78, 3 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[4-(bromomethyl)phenyl]sulfonyl-4,4-dimethylazepane is sourced from PubChem (CID 65481831), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).