C14H19Br2NO2S — CID 65282364
1-(2,4-dibromophenyl)sulfonyl-4,4-dimethylazepane (PubChem CID 65282364) has the molecular formula C14H19Br2NO2S and a molecular weight of 425.19 g/mol. Its IUPAC name is 1-(2,4-dibromophenyl)sulfonyl-4,4-dimethylazepane.
| Compound Name | 1-(2,4-dibromophenyl)sulfonyl-4,4-dimethylazepane |
|---|---|
| PubChem CID | 65282364 |
| Molecular Formula | C14H19Br2NO2S |
| Molecular Weight | 425.19 g/mol |
| Exact Mass | 422.95 |
| IUPAC Name | 1-(2,4-dibromophenyl)sulfonyl-4,4-dimethylazepane |
| SMILES | CC1(C)CCCN(S(=O)(=O)c2ccc(Br)cc2Br)CC1 |
| InChI | InChI=1S/C14H19Br2NO2S/c1-14(2)6-3-8-17(9-7-14)20(18,19)13-5-4-11(15)10-12(13)16/h4-5,10H,3,6-9H2,1-2H3 |
| InChIKey | WWCPZJQDEHTJEZ-UHFFFAOYSA-N |
| XLogP | 4.41 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.19 |
| LogP ≤ 5 | 4.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |