C14H20BrNO3S — CID 62922390
1-(5-bromo-2-methoxyphenyl)sulfonyl-4,4-dimethylpiperidine (PubChem CID 62922390) has the molecular formula C14H20BrNO3S and a molecular weight of 362.29 g/mol. Its IUPAC name is 1-(5-bromo-2-methoxyphenyl)sulfonyl-4,4-dimethylpiperidine.
| Compound Name | 1-(5-bromo-2-methoxyphenyl)sulfonyl-4,4-dimethylpiperidine |
|---|---|
| PubChem CID | 62922390 |
| Molecular Formula | C14H20BrNO3S |
| Molecular Weight | 362.29 g/mol |
| Exact Mass | 361.03 |
| IUPAC Name | 1-(5-bromo-2-methoxyphenyl)sulfonyl-4,4-dimethylpiperidine |
| SMILES | COc1ccc(Br)cc1S(=O)(=O)N1CCC(C)(C)CC1 |
| InChI | InChI=1S/C14H20BrNO3S/c1-14(2)6-8-16(9-7-14)20(17,18)13-10-11(15)4-5-12(13)19-3/h4-5,10H,6-9H2,1-3H3 |
| InChIKey | VYDSYOBINRPGKN-UHFFFAOYSA-N |
| XLogP | 3.27 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.29 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |