C14H20BrNO2S2 — CID 107458002
4-[4-(bromomethyl)phenyl]sulfonyl-7,7-dimethyl-1,4-thiazepane (PubChem CID 107458002) has the molecular formula C14H20BrNO2S2 and a molecular weight of 378.36 g/mol. Its IUPAC name is 4-[4-(bromomethyl)phenyl]sulfonyl-7,7-dimethyl-1,4-thiazepane.
| Compound Name | 4-[4-(bromomethyl)phenyl]sulfonyl-7,7-dimethyl-1,4-thiazepane |
|---|---|
| PubChem CID | 107458002 |
| Molecular Formula | C14H20BrNO2S2 |
| Molecular Weight | 378.36 g/mol |
| Exact Mass | 377.01 |
| IUPAC Name | 4-[4-(bromomethyl)phenyl]sulfonyl-7,7-dimethyl-1,4-thiazepane |
| SMILES | CC1(C)CCN(S(=O)(=O)c2ccc(CBr)cc2)CCS1 |
| InChI | InChI=1S/C14H20BrNO2S2/c1-14(2)7-8-16(9-10-19-14)20(17,18)13-5-3-12(11-15)4-6-13/h3-6H,7-11H2,1-2H3 |
| InChIKey | LGKAPGHCHPCDRQ-UHFFFAOYSA-N |
| XLogP | 3.49 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.36 |
| LogP ≤ 5 | 3.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|