C12H18ClNO2S3 — CID 107459952
4-[2-(chloromethyl)thiophen-3-yl]sulfonyl-7,7-dimethyl-1,4-thiazepane (PubChem CID 107459952) has the molecular formula C12H18ClNO2S3 and a molecular weight of 339.94 g/mol. Its IUPAC name is 4-[2-(chloromethyl)thiophen-3-yl]sulfonyl-7,7-dimethyl-1,4-thiazepane.
| Compound Name | 4-[2-(chloromethyl)thiophen-3-yl]sulfonyl-7,7-dimethyl-1,4-thiazepane |
|---|---|
| PubChem CID | 107459952 |
| Molecular Formula | C12H18ClNO2S3 |
| Molecular Weight | 339.94 g/mol |
| Exact Mass | 339.02 |
| IUPAC Name | 4-[2-(chloromethyl)thiophen-3-yl]sulfonyl-7,7-dimethyl-1,4-thiazepane |
| SMILES | CC1(C)CCN(S(=O)(=O)c2ccsc2CCl)CCS1 |
| InChI | InChI=1S/C12H18ClNO2S3/c1-12(2)4-5-14(6-8-18-12)19(15,16)11-3-7-17-10(11)9-13/h3,7H,4-6,8-9H2,1-2H3 |
| InChIKey | NPPRUEMQTIQLPS-UHFFFAOYSA-N |
| XLogP | 3.39 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.94 |
| LogP ≤ 5 | 3.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|