C13H19FN2O2S2 — CID 107452666
2-[(7,7-dimethyl-1,4-thiazepan-4-yl)sulfonyl]-6-fluoroaniline (PubChem CID 107452666) has the molecular formula C13H19FN2O2S2 and a molecular weight of 318.44 g/mol. Its IUPAC name is 2-[(7,7-dimethyl-1,4-thiazepan-4-yl)sulfonyl]-6-fluoroaniline.
| Compound Name | 2-[(7,7-dimethyl-1,4-thiazepan-4-yl)sulfonyl]-6-fluoroaniline |
|---|---|
| PubChem CID | 107452666 |
| Molecular Formula | C13H19FN2O2S2 |
| Molecular Weight | 318.44 g/mol |
| Exact Mass | 318.09 |
| IUPAC Name | 2-[(7,7-dimethyl-1,4-thiazepan-4-yl)sulfonyl]-6-fluoroaniline |
| SMILES | CC1(C)CCN(S(=O)(=O)c2cccc(F)c2N)CCS1 |
| InChI | InChI=1S/C13H19FN2O2S2/c1-13(2)6-7-16(8-9-19-13)20(17,18)11-5-3-4-10(14)12(11)15/h3-5H,6-9,15H2,1-2H3 |
| InChIKey | IDNUAMCJMSKNHI-UHFFFAOYSA-N |
| XLogP | 2.31 |
| TPSA | 63.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.44 |
| LogP ≤ 5 | 2.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|