C15H21NO4S — CID 3379058
8-(4-ethylphenyl)sulfonyl-1,4-dioxa-8-azaspiro[4.5]decane (PubChem CID 3379058) has the molecular formula C15H21NO4S and a molecular weight of 311.40 g/mol. Its IUPAC name is 8-(4-ethylphenyl)sulfonyl-1,4-dioxa-8-azaspiro[4.5]decane.
| Compound Name | 8-(4-ethylphenyl)sulfonyl-1,4-dioxa-8-azaspiro[4.5]decane |
|---|---|
| PubChem CID | 3379058 |
| Molecular Formula | C15H21NO4S |
| Molecular Weight | 311.40 g/mol |
| Exact Mass | 311.12 |
| IUPAC Name | 8-(4-ethylphenyl)sulfonyl-1,4-dioxa-8-azaspiro[4.5]decane |
| SMILES | CCc1ccc(S(=O)(=O)N2CCC3(CC2)OCCO3)cc1 |
| InChI | InChI=1S/C15H21NO4S/c1-2-13-3-5-14(6-4-13)21(17,18)16-9-7-15(8-10-16)19-11-12-20-15/h3-6H,2,7-12H2,1H3 |
| InChIKey | LMFADHYASDUHAH-UHFFFAOYSA-N |
| XLogP | 1.78 |
| TPSA | 55.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.40 |
| LogP ≤ 5 | 1.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |