C21H23N3O3S — CID 53029731
8-(4-ethylphenyl)sulfonyl-3-phenyl-1,4,8-triazaspiro[4.5]dec-3-en-2-one (PubChem CID 53029731) has the molecular formula C21H23N3O3S and a molecular weight of 397.50 g/mol. Its IUPAC name is 8-(4-ethylphenyl)sulfonyl-3-phenyl-1,4,8-triazaspiro[4.5]dec-3-en-2-one.
| Compound Name | 8-(4-ethylphenyl)sulfonyl-3-phenyl-1,4,8-triazaspiro[4.5]dec-3-en-2-one |
|---|---|
| PubChem CID | 53029731 |
| Molecular Formula | C21H23N3O3S |
| Molecular Weight | 397.50 g/mol |
| Exact Mass | 397.15 |
| IUPAC Name | 8-(4-ethylphenyl)sulfonyl-3-phenyl-1,4,8-triazaspiro[4.5]dec-3-en-2-one |
| SMILES | CCc1ccc(S(=O)(=O)N2CCC3(CC2)N=C(c2ccccc2)C(=O)N3)cc1 |
| InChI | InChI=1S/C21H23N3O3S/c1-2-16-8-10-18(11-9-16)28(26,27)24-14-12-21(13-15-24)22-19(20(25)23-21)17-6-4-3-5-7-17/h3-11H,2,12-15H2,1H3,(H,23,25) |
| InChIKey | BGFFWMYKNAQOTP-UHFFFAOYSA-N |
| XLogP | 2.35 |
| TPSA | 78.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.50 |
| LogP ≤ 5 | 2.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |