C29H33N3O3S — CID 11577002
2,4-dibenzyl-8-(4-ethylphenyl)sulfonyl-1,4,8-triazaspiro[4.5]decan-3-one (PubChem CID 11577002) has the molecular formula C29H33N3O3S and a molecular weight of 503.67 g/mol. Its IUPAC name is 2,4-dibenzyl-8-(4-ethylphenyl)sulfonyl-1,4,8-triazaspiro[4.5]decan-3-one.
| Compound Name | 2,4-dibenzyl-8-(4-ethylphenyl)sulfonyl-1,4,8-triazaspiro[4.5]decan-3-one |
|---|---|
| PubChem CID | 11577002 |
| Molecular Formula | C29H33N3O3S |
| Molecular Weight | 503.67 g/mol |
| Exact Mass | 503.22 |
| IUPAC Name | 2,4-dibenzyl-8-(4-ethylphenyl)sulfonyl-1,4,8-triazaspiro[4.5]decan-3-one |
| SMILES | CCc1ccc(S(=O)(=O)N2CCC3(CC2)NC(Cc2ccccc2)C(=O)N3Cc2ccccc2)cc1 |
| InChI | InChI=1S/C29H33N3O3S/c1-2-23-13-15-26(16-14-23)36(34,35)31-19-17-29(18-20-31)30-27(21-24-9-5-3-6-10-24)28(33)32(29)22-25-11-7-4-8-12-25/h3-16,27,30H,2,17-22H2,1H3 |
| InChIKey | SEWCJZFNPFZAKY-UHFFFAOYSA-N |
| XLogP | 3.97 |
| TPSA | 69.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 503.67 |
| LogP ≤ 5 | 3.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |