C25H27N3O3S2 — CID 11591125
2,4-dibenzyl-8-thiophen-2-ylsulfonyl-1,4,8-triazaspiro[4.5]decan-3-one (PubChem CID 11591125) has the molecular formula C25H27N3O3S2 and a molecular weight of 481.64 g/mol. Its IUPAC name is 2,4-dibenzyl-8-thiophen-2-ylsulfonyl-1,4,8-triazaspiro[4.5]decan-3-one.
| Compound Name | 2,4-dibenzyl-8-thiophen-2-ylsulfonyl-1,4,8-triazaspiro[4.5]decan-3-one |
|---|---|
| PubChem CID | 11591125 |
| Molecular Formula | C25H27N3O3S2 |
| Molecular Weight | 481.64 g/mol |
| Exact Mass | 481.15 |
| IUPAC Name | 2,4-dibenzyl-8-thiophen-2-ylsulfonyl-1,4,8-triazaspiro[4.5]decan-3-one |
| SMILES | O=C1C(Cc2ccccc2)NC2(CCN(S(=O)(=O)c3cccs3)CC2)N1Cc1ccccc1 |
| InChI | InChI=1S/C25H27N3O3S2/c29-24-22(18-20-8-3-1-4-9-20)26-25(28(24)19-21-10-5-2-6-11-21)13-15-27(16-14-25)33(30,31)23-12-7-17-32-23/h1-12,17,22,26H,13-16,18-19H2 |
| InChIKey | LUVUPNOKGDCFFD-UHFFFAOYSA-N |
| XLogP | 3.47 |
| TPSA | 69.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 481.64 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |