C29H31N3O3 — CID 67166062
(2S)-2,4-dibenzyl-8-(3-methoxybenzoyl)-1,4,8-triazaspiro[4.5]decan-3-one (PubChem CID 67166062) has the molecular formula C29H31N3O3 and a molecular weight of 469.59 g/mol. Its IUPAC name is (2S)-2,4-dibenzyl-8-(3-methoxybenzoyl)-1,4,8-triazaspiro[4.5]decan-3-one.
| Compound Name | (2S)-2,4-dibenzyl-8-(3-methoxybenzoyl)-1,4,8-triazaspiro[4.5]decan-3-one |
|---|---|
| PubChem CID | 67166062 |
| Molecular Formula | C29H31N3O3 |
| Molecular Weight | 469.59 g/mol |
| Exact Mass | 469.24 |
| IUPAC Name | (2S)-2,4-dibenzyl-8-(3-methoxybenzoyl)-1,4,8-triazaspiro[4.5]decan-3-one |
| SMILES | COc1cccc(C(=O)N2CCC3(CC2)N[C@@H](Cc2ccccc2)C(=O)N3Cc2ccccc2)c1 |
| InChI | InChI=1S/C29H31N3O3/c1-35-25-14-8-13-24(20-25)27(33)31-17-15-29(16-18-31)30-26(19-22-9-4-2-5-10-22)28(34)32(29)21-23-11-6-3-7-12-23/h2-14,20,26,30H,15-19,21H2,1H3/t26-/m0/s1 |
| InChIKey | XRBNAKLOCVXNSG-SANMLTNESA-N |
| XLogP | 3.87 |
| TPSA | 61.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 469.59 |
| LogP ≤ 5 | 3.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |