C28H28ClN3O2 — CID 67165685
(2S)-2,4-dibenzyl-8-(4-chlorobenzoyl)-1,4,8-triazaspiro[4.5]decan-3-one (PubChem CID 67165685) has the molecular formula C28H28ClN3O2 and a molecular weight of 474.00 g/mol. Its IUPAC name is (2S)-2,4-dibenzyl-8-(4-chlorobenzoyl)-1,4,8-triazaspiro[4.5]decan-3-one.
| Compound Name | (2S)-2,4-dibenzyl-8-(4-chlorobenzoyl)-1,4,8-triazaspiro[4.5]decan-3-one |
|---|---|
| PubChem CID | 67165685 |
| Molecular Formula | C28H28ClN3O2 |
| Molecular Weight | 474.00 g/mol |
| Exact Mass | 473.19 |
| IUPAC Name | (2S)-2,4-dibenzyl-8-(4-chlorobenzoyl)-1,4,8-triazaspiro[4.5]decan-3-one |
| SMILES | O=C(c1ccc(Cl)cc1)N1CCC2(CC1)N[C@@H](Cc1ccccc1)C(=O)N2Cc1ccccc1 |
| InChI | InChI=1S/C28H28ClN3O2/c29-24-13-11-23(12-14-24)26(33)31-17-15-28(16-18-31)30-25(19-21-7-3-1-4-8-21)27(34)32(28)20-22-9-5-2-6-10-22/h1-14,25,30H,15-20H2/t25-/m0/s1 |
| InChIKey | NVZQVNUJCMONJS-VWLOTQADSA-N |
| XLogP | 4.52 |
| TPSA | 52.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.00 |
| LogP ≤ 5 | 4.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |