C29H32FN3O3S — CID 162164527
anisole;2-benzyl-4-[(2-fluorophenyl)methyl]-3-oxo-1,4,8-triazaspiro[4.5]decane-8-carbothioic S-acid (PubChem CID 162164527) has the molecular formula C29H32FN3O3S and a molecular weight of 521.66 g/mol. Its IUPAC name is anisole;2-benzyl-4-[(2-fluorophenyl)methyl]-3-oxo-1,4,8-triazaspiro[4.5]decane-8-carbothioic S-acid.
| Compound Name | anisole;2-benzyl-4-[(2-fluorophenyl)methyl]-3-oxo-1,4,8-triazaspiro[4.5]decane-8-carbothioic S-acid |
|---|---|
| PubChem CID | 162164527 |
| Molecular Formula | C29H32FN3O3S |
| Molecular Weight | 521.66 g/mol |
| Exact Mass | 521.21 |
| IUPAC Name | anisole;2-benzyl-4-[(2-fluorophenyl)methyl]-3-oxo-1,4,8-triazaspiro[4.5]decane-8-carbothioic S-acid |
| SMILES | COc1ccccc1.O=C(S)N1CCC2(CC1)NC(Cc1ccccc1)C(=O)N2Cc1ccccc1F |
| InChI | InChI=1S/C22H24FN3O2S.C7H8O/c23-18-9-5-4-8-17(18)15-26-20(27)19(14-16-6-2-1-3-7-16)24-22(26)10-12-25(13-11-22)21(28)29;1-8-7-5-3-2-4-6-7/h1-9,19,24H,10-15H2,(H,28,29);2-6H,1H3 |
| InChIKey | ZMYFXMRMNPZFFW-UHFFFAOYSA-N |
| XLogP | 4.91 |
| TPSA | 61.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 521.66 |
| LogP ≤ 5 | 4.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|