C14H17NO6S — CID 23884260
4-(1,4-dioxa-8-azaspiro[4.5]decan-8-ylsulfonyl)benzoic acid (PubChem CID 23884260) has the molecular formula C14H17NO6S and a molecular weight of 327.36 g/mol. Its IUPAC name is 4-(1,4-dioxa-8-azaspiro[4.5]decan-8-ylsulfonyl)benzoic acid.
| Compound Name | 4-(1,4-dioxa-8-azaspiro[4.5]decan-8-ylsulfonyl)benzoic acid |
|---|---|
| PubChem CID | 23884260 |
| Molecular Formula | C14H17NO6S |
| Molecular Weight | 327.36 g/mol |
| Exact Mass | 327.08 |
| IUPAC Name | 4-(1,4-dioxa-8-azaspiro[4.5]decan-8-ylsulfonyl)benzoic acid |
| SMILES | O=C(O)c1ccc(S(=O)(=O)N2CCC3(CC2)OCCO3)cc1 |
| InChI | InChI=1S/C14H17NO6S/c16-13(17)11-1-3-12(4-2-11)22(18,19)15-7-5-14(6-8-15)20-9-10-21-14/h1-4H,5-10H2,(H,16,17) |
| InChIKey | FOSBDWJMALAASX-UHFFFAOYSA-N |
| XLogP | 0.91 |
| TPSA | 93.14 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.36 |
| LogP ≤ 5 | 0.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |