C21H23IN2O5S — CID 163682998
N-[4-(1,4-dioxa-8-azaspiro[4.5]decan-8-ylsulfonyl)phenyl]-3-iodo-4-methylbenzamide (PubChem CID 163682998) has the molecular formula C21H23IN2O5S and a molecular weight of 542.40 g/mol. Its IUPAC name is N-[4-(1,4-dioxa-8-azaspiro[4.5]decan-8-ylsulfonyl)phenyl]-3-iodo-4-methylbenzamide.
| Compound Name | N-[4-(1,4-dioxa-8-azaspiro[4.5]decan-8-ylsulfonyl)phenyl]-3-iodo-4-methylbenzamide |
|---|---|
| PubChem CID | 163682998 |
| Molecular Formula | C21H23IN2O5S |
| Molecular Weight | 542.40 g/mol |
| Exact Mass | 542.04 |
| IUPAC Name | N-[4-(1,4-dioxa-8-azaspiro[4.5]decan-8-ylsulfonyl)phenyl]-3-iodo-4-methylbenzamide |
| SMILES | Cc1ccc(C(=O)Nc2ccc(S(=O)(=O)N3CCC4(CC3)OCCO4)cc2)cc1I |
| InChI | InChI=1S/C21H23IN2O5S/c1-15-2-3-16(14-19(15)22)20(25)23-17-4-6-18(7-5-17)30(26,27)24-10-8-21(9-11-24)28-12-13-29-21/h2-7,14H,8-13H2,1H3,(H,23,25) |
| InChIKey | JMJVGSAJWYMADJ-UHFFFAOYSA-N |
| XLogP | 3.38 |
| TPSA | 84.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 542.40 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|