C18H27NO4S — CID 3777515
9-(4-butylphenyl)sulfonyl-1,5-dioxa-9-azaspiro[5.5]undecane (PubChem CID 3777515) has the molecular formula C18H27NO4S and a molecular weight of 353.48 g/mol. Its IUPAC name is 9-(4-butylphenyl)sulfonyl-1,5-dioxa-9-azaspiro[5.5]undecane.
| Compound Name | 9-(4-butylphenyl)sulfonyl-1,5-dioxa-9-azaspiro[5.5]undecane |
|---|---|
| PubChem CID | 3777515 |
| Molecular Formula | C18H27NO4S |
| Molecular Weight | 353.48 g/mol |
| Exact Mass | 353.17 |
| IUPAC Name | 9-(4-butylphenyl)sulfonyl-1,5-dioxa-9-azaspiro[5.5]undecane |
| SMILES | CCCCc1ccc(S(=O)(=O)N2CCC3(CC2)OCCCO3)cc1 |
| InChI | InChI=1S/C18H27NO4S/c1-2-3-5-16-6-8-17(9-7-16)24(20,21)19-12-10-18(11-13-19)22-14-4-15-23-18/h6-9H,2-5,10-15H2,1H3 |
| InChIKey | DMBNEEUHMYBQME-UHFFFAOYSA-N |
| XLogP | 2.95 |
| TPSA | 55.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.48 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |