C20H25N3O5S2 — CID 4690747
N-[4-[[4-(4-methylsulfonylphenyl)-1,4-diazepan-1-yl]sulfonyl]phenyl]acetamide (PubChem CID 4690747) has the molecular formula C20H25N3O5S2 and a molecular weight of 451.57 g/mol. Its IUPAC name is N-[4-[[4-(4-methylsulfonylphenyl)-1,4-diazepan-1-yl]sulfonyl]phenyl]acetamide.
| Compound Name | N-[4-[[4-(4-methylsulfonylphenyl)-1,4-diazepan-1-yl]sulfonyl]phenyl]acetamide |
|---|---|
| PubChem CID | 4690747 |
| Molecular Formula | C20H25N3O5S2 |
| Molecular Weight | 451.57 g/mol |
| Exact Mass | 451.12 |
| IUPAC Name | N-[4-[[4-(4-methylsulfonylphenyl)-1,4-diazepan-1-yl]sulfonyl]phenyl]acetamide |
| SMILES | CC(=O)Nc1ccc(S(=O)(=O)N2CCCN(c3ccc(S(C)(=O)=O)cc3)CC2)cc1 |
| InChI | InChI=1S/C20H25N3O5S2/c1-16(24)21-17-4-8-20(9-5-17)30(27,28)23-13-3-12-22(14-15-23)18-6-10-19(11-7-18)29(2,25)26/h4-11H,3,12-15H2,1-2H3,(H,21,24) |
| InChIKey | SHFIXCXJSGVYAA-UHFFFAOYSA-N |
| XLogP | 1.95 |
| TPSA | 103.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.57 |
| LogP ≤ 5 | 1.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |