C20H26N6O3S — CID 71807528
N-[4-[4-(6-pyrrolidin-1-ylpyridazin-4-yl)piperazin-1-yl]sulfonylphenyl]acetamide (PubChem CID 71807528) has the molecular formula C20H26N6O3S and a molecular weight of 430.53 g/mol. Its IUPAC name is N-[4-[4-(6-pyrrolidin-1-ylpyridazin-4-yl)piperazin-1-yl]sulfonylphenyl]acetamide.
| Compound Name | N-[4-[4-(6-pyrrolidin-1-ylpyridazin-4-yl)piperazin-1-yl]sulfonylphenyl]acetamide |
|---|---|
| PubChem CID | 71807528 |
| Molecular Formula | C20H26N6O3S |
| Molecular Weight | 430.53 g/mol |
| Exact Mass | 430.18 |
| IUPAC Name | N-[4-[4-(6-pyrrolidin-1-ylpyridazin-4-yl)piperazin-1-yl]sulfonylphenyl]acetamide |
| SMILES | CC(=O)Nc1ccc(S(=O)(=O)N2CCN(c3cnnc(N4CCCC4)c3)CC2)cc1 |
| InChI | InChI=1S/C20H26N6O3S/c1-16(27)22-17-4-6-19(7-5-17)30(28,29)26-12-10-24(11-13-26)18-14-20(23-21-15-18)25-8-2-3-9-25/h4-7,14-15H,2-3,8-13H2,1H3,(H,22,27) |
| InChIKey | MDDKIPKVUCPOMV-UHFFFAOYSA-N |
| XLogP | 1.55 |
| TPSA | 98.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.53 |
| LogP ≤ 5 | 1.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |