C20H25ClN4O3S2 — CID 163329884
1-(3-acetylphenyl)-3-[4-(4-methylpiperazin-1-yl)sulfonylphenyl]thiourea;hydrochloride (PubChem CID 163329884) has the molecular formula C20H25ClN4O3S2 and a molecular weight of 469.03 g/mol. Its IUPAC name is 1-(3-acetylphenyl)-3-[4-(4-methylpiperazin-1-yl)sulfonylphenyl]thiourea;hydrochloride.
| Compound Name | 1-(3-acetylphenyl)-3-[4-(4-methylpiperazin-1-yl)sulfonylphenyl]thiourea;hydrochloride |
|---|---|
| PubChem CID | 163329884 |
| Molecular Formula | C20H25ClN4O3S2 |
| Molecular Weight | 469.03 g/mol |
| Exact Mass | 468.11 |
| IUPAC Name | 1-(3-acetylphenyl)-3-[4-(4-methylpiperazin-1-yl)sulfonylphenyl]thiourea;hydrochloride |
| SMILES | CC(=O)c1cccc(NC(=S)Nc2ccc(S(=O)(=O)N3CCN(C)CC3)cc2)c1.Cl |
| InChI | InChI=1S/C20H24N4O3S2.ClH/c1-15(25)16-4-3-5-18(14-16)22-20(28)21-17-6-8-19(9-7-17)29(26,27)24-12-10-23(2)11-13-24;/h3-9,14H,10-13H2,1-2H3,(H2,21,22,28);1H |
| InChIKey | URZQDMQPBQODNA-UHFFFAOYSA-N |
| XLogP | 3.06 |
| TPSA | 81.75 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 469.03 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|