C18H26FN3O2S2 — CID 8745724
4-(2-fluorophenyl)sulfonyl-N-[(1S,2R)-2-methylcyclohexyl]piperazine-1-carbothioamide (PubChem CID 8745724) has the molecular formula C18H26FN3O2S2 and a molecular weight of 399.56 g/mol. Its IUPAC name is 4-(2-fluorophenyl)sulfonyl-N-[(1S,2R)-2-methylcyclohexyl]piperazine-1-carbothioamide.
| Compound Name | 4-(2-fluorophenyl)sulfonyl-N-[(1S,2R)-2-methylcyclohexyl]piperazine-1-carbothioamide |
|---|---|
| PubChem CID | 8745724 |
| Molecular Formula | C18H26FN3O2S2 |
| Molecular Weight | 399.56 g/mol |
| Exact Mass | 399.15 |
| IUPAC Name | 4-(2-fluorophenyl)sulfonyl-N-[(1S,2R)-2-methylcyclohexyl]piperazine-1-carbothioamide |
| SMILES | C[C@@H]1CCCC[C@@H]1NC(=S)N1CCN(S(=O)(=O)c2ccccc2F)CC1 |
| InChI | InChI=1S/C18H26FN3O2S2/c1-14-6-2-4-8-16(14)20-18(25)21-10-12-22(13-11-21)26(23,24)17-9-5-3-7-15(17)19/h3,5,7,9,14,16H,2,4,6,8,10-13H2,1H3,(H,20,25)/t14-,16+/m1/s1 |
| InChIKey | WPJQKCPHYLPIOA-ZBFHGGJFSA-N |
| XLogP | 2.59 |
| TPSA | 52.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.56 |
| LogP ≤ 5 | 2.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|