C21H33N3O2 — CID 94437071
2-[4-(4-methoxyphenyl)-1,4-diazepan-1-yl]-N-[(1R,2R)-2-methylcyclohexyl]acetamide (PubChem CID 94437071) has the molecular formula C21H33N3O2 and a molecular weight of 359.51 g/mol. Its IUPAC name is 2-[4-(4-methoxyphenyl)-1,4-diazepan-1-yl]-N-[(1R,2R)-2-methylcyclohexyl]acetamide.
| Compound Name | 2-[4-(4-methoxyphenyl)-1,4-diazepan-1-yl]-N-[(1R,2R)-2-methylcyclohexyl]acetamide |
|---|---|
| PubChem CID | 94437071 |
| Molecular Formula | C21H33N3O2 |
| Molecular Weight | 359.51 g/mol |
| Exact Mass | 359.26 |
| IUPAC Name | 2-[4-(4-methoxyphenyl)-1,4-diazepan-1-yl]-N-[(1R,2R)-2-methylcyclohexyl]acetamide |
| SMILES | COc1ccc(N2CCCN(CC(=O)N[C@@H]3CCCC[C@H]3C)CC2)cc1 |
| InChI | InChI=1S/C21H33N3O2/c1-17-6-3-4-7-20(17)22-21(25)16-23-12-5-13-24(15-14-23)18-8-10-19(26-2)11-9-18/h8-11,17,20H,3-7,12-16H2,1-2H3,(H,22,25)/t17-,20-/m1/s1 |
| InChIKey | UINDBMZZNDHKHP-YLJYHZDGSA-N |
| XLogP | 2.90 |
| TPSA | 44.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.51 |
| LogP ≤ 5 | 2.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|