C24H31N3O5S — CID 42913706
ethyl 4-[4-[2-[1-(2-methylphenyl)ethylamino]-2-oxoethyl]piperazin-1-yl]sulfonylbenzoate (PubChem CID 42913706) has the molecular formula C24H31N3O5S and a molecular weight of 473.60 g/mol. Its IUPAC name is ethyl 4-[4-[2-[1-(2-methylphenyl)ethylamino]-2-oxoethyl]piperazin-1-yl]sulfonylbenzoate.
| Compound Name | ethyl 4-[4-[2-[1-(2-methylphenyl)ethylamino]-2-oxoethyl]piperazin-1-yl]sulfonylbenzoate |
|---|---|
| PubChem CID | 42913706 |
| Molecular Formula | C24H31N3O5S |
| Molecular Weight | 473.60 g/mol |
| Exact Mass | 473.20 |
| IUPAC Name | ethyl 4-[4-[2-[1-(2-methylphenyl)ethylamino]-2-oxoethyl]piperazin-1-yl]sulfonylbenzoate |
| SMILES | CCOC(=O)c1ccc(S(=O)(=O)N2CCN(CC(=O)NC(C)c3ccccc3C)CC2)cc1 |
| InChI | InChI=1S/C24H31N3O5S/c1-4-32-24(29)20-9-11-21(12-10-20)33(30,31)27-15-13-26(14-16-27)17-23(28)25-19(3)22-8-6-5-7-18(22)2/h5-12,19H,4,13-17H2,1-3H3,(H,25,28) |
| InChIKey | SZIXKCLONLOYCM-UHFFFAOYSA-N |
| XLogP | 2.36 |
| TPSA | 96.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 473.60 |
| LogP ≤ 5 | 2.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |