C21H35N5O5S — CID 55633380
N-(3-methoxypropyl)-2-[4-(1-methyl-4-piperidin-1-ylsulfonylpyrrole-2-carbonyl)piperazin-1-yl]acetamide (PubChem CID 55633380) has the molecular formula C21H35N5O5S and a molecular weight of 469.61 g/mol. Its IUPAC name is N-(3-methoxypropyl)-2-[4-(1-methyl-4-piperidin-1-ylsulfonylpyrrole-2-carbonyl)piperazin-1-yl]acetamide.
| Compound Name | N-(3-methoxypropyl)-2-[4-(1-methyl-4-piperidin-1-ylsulfonylpyrrole-2-carbonyl)piperazin-1-yl]acetamide |
|---|---|
| PubChem CID | 55633380 |
| Molecular Formula | C21H35N5O5S |
| Molecular Weight | 469.61 g/mol |
| Exact Mass | 469.24 |
| IUPAC Name | N-(3-methoxypropyl)-2-[4-(1-methyl-4-piperidin-1-ylsulfonylpyrrole-2-carbonyl)piperazin-1-yl]acetamide |
| SMILES | COCCCNC(=O)CN1CCN(C(=O)c2cc(S(=O)(=O)N3CCCCC3)cn2C)CC1 |
| InChI | InChI=1S/C21H35N5O5S/c1-23-16-18(32(29,30)26-8-4-3-5-9-26)15-19(23)21(28)25-12-10-24(11-13-25)17-20(27)22-7-6-14-31-2/h15-16H,3-14,17H2,1-2H3,(H,22,27) |
| InChIKey | WCMJRWOUIAJUKA-UHFFFAOYSA-N |
| XLogP | 0.11 |
| TPSA | 104.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 469.61 |
| LogP ≤ 5 | 0.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|