C23H37N5O4 — CID 55445521
N-(2-ethylphenyl)-2-[4-[2-[[2-(3-methoxypropylamino)-2-oxoethyl]-methylamino]acetyl]piperazin-1-yl]acetamide (PubChem CID 55445521) has the molecular formula C23H37N5O4 and a molecular weight of 447.58 g/mol. Its IUPAC name is N-(2-ethylphenyl)-2-[4-[2-[[2-(3-methoxypropylamino)-2-oxoethyl]-methylamino]acetyl]piperazin-1-yl]acetamide.
| Compound Name | N-(2-ethylphenyl)-2-[4-[2-[[2-(3-methoxypropylamino)-2-oxoethyl]-methylamino]acetyl]piperazin-1-yl]acetamide |
|---|---|
| PubChem CID | 55445521 |
| Molecular Formula | C23H37N5O4 |
| Molecular Weight | 447.58 g/mol |
| Exact Mass | 447.28 |
| IUPAC Name | N-(2-ethylphenyl)-2-[4-[2-[[2-(3-methoxypropylamino)-2-oxoethyl]-methylamino]acetyl]piperazin-1-yl]acetamide |
| SMILES | CCc1ccccc1NC(=O)CN1CCN(C(=O)CN(C)CC(=O)NCCCOC)CC1 |
| InChI | InChI=1S/C23H37N5O4/c1-4-19-8-5-6-9-20(19)25-22(30)17-27-11-13-28(14-12-27)23(31)18-26(2)16-21(29)24-10-7-15-32-3/h5-6,8-9H,4,7,10-18H2,1-3H3,(H,24,29)(H,25,30) |
| InChIKey | NMSVPGCDKIEDKH-UHFFFAOYSA-N |
| XLogP | 0.42 |
| TPSA | 94.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.58 |
| LogP ≤ 5 | 0.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|